C21H25F2NO3 — CID 144584295
ethyl (1S,3'S,5'R)-6-cyano-4'-(difluoromethoxy)-3',5'-dimethylspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-carboxylate (PubChem CID 144584295) has the molecular formula C21H25F2NO3 and a molecular weight of 377.43 g/mol. Its IUPAC name is ethyl (1S,3'S,5'R)-6-cyano-4'-(difluoromethoxy)-3',5'-dimethylspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-carboxylate.
| Compound Name | ethyl (1S,3'S,5'R)-6-cyano-4'-(difluoromethoxy)-3',5'-dimethylspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-carboxylate |
|---|---|
| PubChem CID | 144584295 |
| Molecular Formula | C21H25F2NO3 |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | ethyl (1S,3'S,5'R)-6-cyano-4'-(difluoromethoxy)-3',5'-dimethylspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1c2cc(C#N)ccc2CC12C[C@@H](C)C(OC(F)F)[C@@H](C)C2 |
| InChI | InChI=1S/C21H25F2NO3/c1-4-26-19(25)17-16-7-14(11-24)5-6-15(16)10-21(17)8-12(2)18(13(3)9-21)27-20(22)23/h5-7,12-13,17-18,20H,4,8-10H2,1-3H3/t12-,13+,17-,18?,21?/m0/s1 |
| InChIKey | DPTJSIPYNQEWSI-LXQRILFASA-N |
| XLogP | 4.42 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |