C27H43FN4O3 — CID 144584302
tert-butyl (NE)-N-[amino-[[6-amino-2-(2,4-dimethylpentyl)-2,3-dihydro-1H-indene-1-carbonyl]-(2-fluoro-2-methylpropyl)amino]methylidene]carbamate (PubChem CID 144584302) has the molecular formula C27H43FN4O3 and a molecular weight of 490.66 g/mol. Its IUPAC name is tert-butyl (NE)-N-[amino-[[6-amino-2-(2,4-dimethylpentyl)-2,3-dihydro-1H-indene-1-carbonyl]-(2-fluoro-2-methylpropyl)amino]methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[amino-[[6-amino-2-(2,4-dimethylpentyl)-2,3-dihydro-1H-indene-1-carbonyl]-(2-fluoro-2-methylpropyl)amino]methylidene]carbamate |
|---|---|
| PubChem CID | 144584302 |
| Molecular Formula | C27H43FN4O3 |
| Molecular Weight | 490.66 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | tert-butyl (NE)-N-[amino-[[6-amino-2-(2,4-dimethylpentyl)-2,3-dihydro-1H-indene-1-carbonyl]-(2-fluoro-2-methylpropyl)amino]methylidene]carbamate |
| SMILES | CC(C)CC(C)CC1Cc2ccc(N)cc2C1C(=O)N(CC(C)(C)F)/C(N)=N/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H43FN4O3/c1-16(2)11-17(3)12-19-13-18-9-10-20(29)14-21(18)22(19)23(33)32(15-27(7,8)28)24(30)31-25(34)35-26(4,5)6/h9-10,14,16-17,19,22H,11-13,15,29H2,1-8H3,(H2,30,31,34) |
| InChIKey | SXCNSXWQTKCJFR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|