C21H19F7N4S — CID 144584330
5-[4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-prop-1-ynylpiperazin-1-yl]sulfanylpyridin-2-amine (PubChem CID 144584330) has the molecular formula C21H19F7N4S and a molecular weight of 492.46 g/mol. Its IUPAC name is 5-[4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-prop-1-ynylpiperazin-1-yl]sulfanylpyridin-2-amine.
| Compound Name | 5-[4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-prop-1-ynylpiperazin-1-yl]sulfanylpyridin-2-amine |
|---|---|
| PubChem CID | 144584330 |
| Molecular Formula | C21H19F7N4S |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 5-[4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-prop-1-ynylpiperazin-1-yl]sulfanylpyridin-2-amine |
| SMILES | CC#CC1CN(Sc2ccc(N)nc2)CCN1c1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F7N4S/c1-2-3-16-13-31(33-17-8-9-18(29)30-12-17)10-11-32(16)15-6-4-14(5-7-15)19(22,20(23,24)25)21(26,27)28/h4-9,12,16H,10-11,13H2,1H3,(H2,29,30) |
| InChIKey | HPVXMRDZNRKDTG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|