About (4R)-N,4-diethyl-7-methyloct-7-en-1-amine
(4R)-N,4-diethyl-7-methyloct-7-en-1-amine (PubChem CID 144585120) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is (4R)-N,4-diethyl-7-methyloct-7-en-1-amine.
Molecular Properties
| Compound Name | (4R)-N,4-diethyl-7-methyloct-7-en-1-amine |
| PubChem CID | 144585120 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | (4R)-N,4-diethyl-7-methyloct-7-en-1-amine |
| SMILES | C=C(C)CC[C@@H](CC)CCCNCC |
| InChI | InChI=1S/C13H27N/c1-5-13(10-9-12(3)4)8-7-11-14-6-2/h13-14H,3,5-11H2,1-2,4H3/t13-/m0/s1 |
| InChIKey | FVQQVBPUWYKXRH-ZDUSSCGKSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-N,4-diethyl-7-methyloct-7-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-N,4-diethyl-7-methyloct-7-en-1-amine?
The IUPAC name of (4R)-N,4-diethyl-7-methyloct-7-en-1-amine (CID 144585120) is (4R)-N,4-diethyl-7-methyloct-7-en-1-amine.
What is the SMILES notation for (4R)-N,4-diethyl-7-methyloct-7-en-1-amine?
The canonical SMILES for (4R)-N,4-diethyl-7-methyloct-7-en-1-amine is C=C(C)CC[C@@H](CC)CCCNCC.
What is the InChIKey of (4R)-N,4-diethyl-7-methyloct-7-en-1-amine?
The InChIKey is FVQQVBPUWYKXRH-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H27N/c1-5-13(10-9-12(3)4)8-7-11-14-6-2/h13-14H,3,5-11H2,1-2,4H3/t13-/m0/s1.
What are the key properties of (4R)-N,4-diethyl-7-methyloct-7-en-1-amine?
(4R)-N,4-diethyl-7-methyloct-7-en-1-amine has a molecular weight of 197.37 g/mol, XLogP of 3.76, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-N,4-diethyl-7-methyloct-7-en-1-amine is sourced from PubChem (CID 144585120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).