About 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine
3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine (PubChem CID 144585651) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine |
| PubChem CID | 144585651 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine |
| SMILES | C=C/C(=C\C)C1=Nc2ccccc2OC1 |
| InChI | InChI=1S/C13H13NO/c1-3-10(4-2)12-9-15-13-8-6-5-7-11(13)14-12/h3-8H,1,9H2,2H3/b10-4+ |
| InChIKey | KTNNMJCLGVQCST-ONNFQVAWSA-N |
| XLogP | 3.28 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine?
The IUPAC name of 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine (CID 144585651) is 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine.
What is the SMILES notation for 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine?
The canonical SMILES for 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine is C=C/C(=C\C)C1=Nc2ccccc2OC1.
What is the InChIKey of 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine?
The InChIKey is KTNNMJCLGVQCST-ONNFQVAWSA-N. The full InChI is InChI=1S/C13H13NO/c1-3-10(4-2)12-9-15-13-8-6-5-7-11(13)14-12/h3-8H,1,9H2,2H3/b10-4+.
What are the key properties of 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine?
3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine has a molecular weight of 199.25 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3E)-penta-1,3-dien-3-yl]-2H-1,4-benzoxazine is sourced from PubChem (CID 144585651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).