C30H22OS2 — CID 144585700
2-[2-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]ethynyl]-7-methyl-[1]benzothiolo[3,2-b][1]benzothiole (PubChem CID 144585700) has the molecular formula C30H22OS2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 2-[2-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]ethynyl]-7-methyl-[1]benzothiolo[3,2-b][1]benzothiole.
| Compound Name | 2-[2-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]ethynyl]-7-methyl-[1]benzothiolo[3,2-b][1]benzothiole |
|---|---|
| PubChem CID | 144585700 |
| Molecular Formula | C30H22OS2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 2-[2-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]ethynyl]-7-methyl-[1]benzothiolo[3,2-b][1]benzothiole |
| SMILES | C=C/C(=C\C=C/C)Oc1ccc(C#Cc2ccc3c(c2)sc2c4ccc(C)cc4sc32)cc1 |
| InChI | InChI=1S/C30H22OS2/c1-4-6-7-23(5-2)31-24-14-11-21(12-15-24)9-10-22-13-17-26-28(19-22)33-29-25-16-8-20(3)18-27(25)32-30(26)29/h4-8,11-19H,2H2,1,3H3/b6-4-,23-7+ |
| InChIKey | YBINFABIVRROIG-NXMMJKDVSA-N |
| XLogP | 9.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|