C24H28FN3O — CID 144586521
(5R)-N-ethoxy-14-(4-fluorophenyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-amine (PubChem CID 144586521) has the molecular formula C24H28FN3O and a molecular weight of 393.51 g/mol. Its IUPAC name is (5R)-N-ethoxy-14-(4-fluorophenyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-amine.
| Compound Name | (5R)-N-ethoxy-14-(4-fluorophenyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-amine |
|---|---|
| PubChem CID | 144586521 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (5R)-N-ethoxy-14-(4-fluorophenyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-amine |
| SMILES | CCON[C@@H]1CCC2c3cc4cnn(-c5ccc(F)cc5)c4cc3CCCC2C1 |
| InChI | InChI=1S/C24H28FN3O/c1-2-29-27-20-8-11-22-16(12-20)4-3-5-17-14-24-18(13-23(17)22)15-26-28(24)21-9-6-19(25)7-10-21/h6-7,9-10,13-16,20,22,27H,2-5,8,11-12H2,1H3/t16?,20-,22?/m1/s1 |
| InChIKey | LHQANRSRJODXOI-PWOUQQLPSA-N |
| XLogP | 5.29 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|