C28H31F4N3O — CID 144586605
(2R,5R,7R)-14-(2-cyclobutyl-4-fluorophenyl)-2-ethyl-5-(trifluoromethyl)-12,14,15-triazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol (PubChem CID 144586605) has the molecular formula C28H31F4N3O and a molecular weight of 501.57 g/mol. Its IUPAC name is (2R,5R,7R)-14-(2-cyclobutyl-4-fluorophenyl)-2-ethyl-5-(trifluoromethyl)-12,14,15-triazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol.
| Compound Name | (2R,5R,7R)-14-(2-cyclobutyl-4-fluorophenyl)-2-ethyl-5-(trifluoromethyl)-12,14,15-triazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol |
|---|---|
| PubChem CID | 144586605 |
| Molecular Formula | C28H31F4N3O |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | (2R,5R,7R)-14-(2-cyclobutyl-4-fluorophenyl)-2-ethyl-5-(trifluoromethyl)-12,14,15-triazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-ol |
| SMILES | CC[C@@]12CC[C@](O)(C(F)(F)F)C[C@H]1CCCc1nc3c(cnn3-c3ccc(F)cc3C3CCC3)cc12 |
| InChI | InChI=1S/C28H31F4N3O/c1-2-26-11-12-27(36,28(30,31)32)15-19(26)7-4-8-23-22(26)13-18-16-33-35(25(18)34-23)24-10-9-20(29)14-21(24)17-5-3-6-17/h9-10,13-14,16-17,19,36H,2-8,11-12,15H2,1H3/t19-,26-,27-/m1/s1 |
| InChIKey | UHOLKBDEPKVEEK-UMGVMLDSSA-N |
| XLogP | 6.90 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |