C18H19NO — CID 144587036
4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(2E,4Z)-octa-2,4-dien-6-yn-3-yl]-1,2-oxazole (PubChem CID 144587036) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(2E,4Z)-octa-2,4-dien-6-yn-3-yl]-1,2-oxazole.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(2E,4Z)-octa-2,4-dien-6-yn-3-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 144587036 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(2E,4Z)-octa-2,4-dien-6-yn-3-yl]-1,2-oxazole |
| SMILES | C=C/C=C(\C=C/C)c1conc1C(/C=C\C#CC)=C/C |
| InChI | InChI=1S/C18H19NO/c1-5-9-10-13-15(8-4)18-17(14-20-19-18)16(11-6-2)12-7-3/h6-8,10-14H,2H2,1,3-4H3/b12-7-,13-10-,15-8+,16-11+ |
| InChIKey | FOOQLVFQDFGOTJ-SNZJSFELSA-N |
| XLogP | 4.80 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|