C16H23BrN2O2 — CID 144588446
1-[3-bromo-1-(3-methoxypropyl)-4-methylindazol-6-yl]ethanone;ethane (PubChem CID 144588446) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is 1-[3-bromo-1-(3-methoxypropyl)-4-methylindazol-6-yl]ethanone;ethane.
| Compound Name | 1-[3-bromo-1-(3-methoxypropyl)-4-methylindazol-6-yl]ethanone;ethane |
|---|---|
| PubChem CID | 144588446 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-[3-bromo-1-(3-methoxypropyl)-4-methylindazol-6-yl]ethanone;ethane |
| SMILES | CC.COCCCn1nc(Br)c2c(C)cc(C(C)=O)cc21 |
| InChI | InChI=1S/C14H17BrN2O2.C2H6/c1-9-7-11(10(2)18)8-12-13(9)14(15)16-17(12)5-4-6-19-3;1-2/h7-8H,4-6H2,1-3H3;1-2H3 |
| InChIKey | BCHILBCNSMXSTF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|