C26H29N3 — CID 144588634
acetylene;2-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-[(2Z,4Z)-5-methylhepta-2,4,6-trienyl]-6-(4-methylphenyl)-1,3,5-triazine (PubChem CID 144588634) has the molecular formula C26H29N3 and a molecular weight of 383.54 g/mol. Its IUPAC name is acetylene;2-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-[(2Z,4Z)-5-methylhepta-2,4,6-trienyl]-6-(4-methylphenyl)-1,3,5-triazine.
| Compound Name | acetylene;2-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-[(2Z,4Z)-5-methylhepta-2,4,6-trienyl]-6-(4-methylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 144588634 |
| Molecular Formula | C26H29N3 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | acetylene;2-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-[(2Z,4Z)-5-methylhepta-2,4,6-trienyl]-6-(4-methylphenyl)-1,3,5-triazine |
| SMILES | C#C.C=C/C(C)=C\C=C/Cc1nc(/C(C)=C/C=C\C)nc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C24H27N3.C2H2/c1-6-8-12-20(5)23-25-22(13-10-9-11-18(3)7-2)26-24(27-23)21-16-14-19(4)15-17-21;1-2/h6-12,14-17H,2,13H2,1,3-5H3;1-2H/b8-6-,10-9-,18-11-,20-12+; |
| InChIKey | UMINJNMGSISDHR-HQWNWOLFSA-N |
| XLogP | 6.31 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|