C40H38N2 — CID 144588655
ethane;N-[(2Z,4Z)-3-methylhepta-2,4,6-trienyl]-N-phenyl-4-(9-phenylcarbazol-3-yl)aniline (PubChem CID 144588655) has the molecular formula C40H38N2 and a molecular weight of 546.76 g/mol. Its IUPAC name is ethane;N-[(2Z,4Z)-3-methylhepta-2,4,6-trienyl]-N-phenyl-4-(9-phenylcarbazol-3-yl)aniline.
| Compound Name | ethane;N-[(2Z,4Z)-3-methylhepta-2,4,6-trienyl]-N-phenyl-4-(9-phenylcarbazol-3-yl)aniline |
|---|---|
| PubChem CID | 144588655 |
| Molecular Formula | C40H38N2 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | ethane;N-[(2Z,4Z)-3-methylhepta-2,4,6-trienyl]-N-phenyl-4-(9-phenylcarbazol-3-yl)aniline |
| SMILES | C=C/C=C\C(C)=C/CN(c1ccccc1)c1ccc(-c2ccc3c(c2)c2ccccc2n3-c2ccccc2)cc1.CC |
| InChI | InChI=1S/C38H32N2.C2H6/c1-3-4-13-29(2)26-27-39(32-14-7-5-8-15-32)33-23-20-30(21-24-33)31-22-25-38-36(28-31)35-18-11-12-19-37(35)40(38)34-16-9-6-10-17-34;1-2/h3-26,28H,1,27H2,2H3;1-2H3/b13-4-,29-26-; |
| InChIKey | MARPNMDWGZYTFV-AFZMTGJZSA-N |
| XLogP | 11.30 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|