C14H18N2 — CID 144588793
4-ethenyl-5-[(3E)-hexa-1,3,5-trien-3-yl]-3-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrazole (PubChem CID 144588793) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 4-ethenyl-5-[(3E)-hexa-1,3,5-trien-3-yl]-3-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrazole.
| Compound Name | 4-ethenyl-5-[(3E)-hexa-1,3,5-trien-3-yl]-3-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 144588793 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 4-ethenyl-5-[(3E)-hexa-1,3,5-trien-3-yl]-3-[(Z)-prop-1-enyl]-2,3-dihydro-1H-pyrazole |
| SMILES | C=C/C=C(\C=C)C1=C(C=C)C(/C=C\C)NN1 |
| InChI | InChI=1S/C14H18N2/c1-5-9-11(7-3)14-12(8-4)13(10-6-2)15-16-14/h5-10,13,15-16H,1,3-4H2,2H3/b10-6-,11-9+ |
| InChIKey | UKOQCOVLBGJMHF-BZLPTDEHSA-N |
| XLogP | 2.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|