C17H14N2 — CID 144588852
2-methyl-6-(4-phenylphenyl)pyrazine (PubChem CID 144588852) has the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-methyl-6-(4-phenylphenyl)pyrazine.
| Compound Name | 2-methyl-6-(4-phenylphenyl)pyrazine |
|---|---|
| PubChem CID | 144588852 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-methyl-6-(4-phenylphenyl)pyrazine |
| SMILES | Cc1cncc(-c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C17H14N2/c1-13-11-18-12-17(19-13)16-9-7-15(8-10-16)14-5-3-2-4-6-14/h2-12H,1H3 |
| InChIKey | ZRRVMCCIIYQRGV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |