C15H14F4O5 — CID 144589045
(2,3,5,6-tetrafluoro-4-propylphenyl) 5-methyl-2-oxo-1,3-dioxane-5-carboxylate (PubChem CID 144589045) has the molecular formula C15H14F4O5 and a molecular weight of 350.26 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-propylphenyl) 5-methyl-2-oxo-1,3-dioxane-5-carboxylate.
| Compound Name | (2,3,5,6-tetrafluoro-4-propylphenyl) 5-methyl-2-oxo-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 144589045 |
| Molecular Formula | C15H14F4O5 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-propylphenyl) 5-methyl-2-oxo-1,3-dioxane-5-carboxylate |
| SMILES | CCCc1c(F)c(F)c(OC(=O)C2(C)COC(=O)OC2)c(F)c1F |
| InChI | InChI=1S/C15H14F4O5/c1-3-4-7-8(16)10(18)12(11(19)9(7)17)24-13(20)15(2)5-22-14(21)23-6-15/h3-6H2,1-2H3 |
| InChIKey | QTUUTSKQDDLHRV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|