C9H16N4O — CID 144589077
3-amino-3-pyridin-3-ylpropanamide;methanamine (PubChem CID 144589077) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-amino-3-pyridin-3-ylpropanamide;methanamine.
| Compound Name | 3-amino-3-pyridin-3-ylpropanamide;methanamine |
|---|---|
| PubChem CID | 144589077 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3-amino-3-pyridin-3-ylpropanamide;methanamine |
| SMILES | CN.NC(=O)CC(N)c1cccnc1 |
| InChI | InChI=1S/C8H11N3O.CH5N/c9-7(4-8(10)12)6-2-1-3-11-5-6;1-2/h1-3,5,7H,4,9H2,(H2,10,12);2H2,1H3 |
| InChIKey | BEURUYNQCNDPQB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |