About ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine
ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine (PubChem CID 144589102) has the molecular formula C15H26F3N
and a molecular weight of 277.37 g/mol. Its IUPAC name is ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine.
Molecular Properties
| Compound Name | ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine |
| PubChem CID | 144589102 |
| Molecular Formula | C15H26F3N |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(=C)C(F)(F)F)N(C)CCC(C)C.CC |
| InChI | InChI=1S/C13H20F3N.C2H6/c1-10(2)8-9-17(5)12(4)7-6-11(3)13(14,15)16;1-2/h6-7,10H,3-4,8-9H2,1-2,5H3;1-2H3/b7-6-; |
| InChIKey | ZUIMWVSTSWYIOJ-NAFXZHHSSA-N |
| XLogP | 5.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine?
The IUPAC name of ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine (CID 144589102) is ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine.
What is the SMILES notation for ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine?
The canonical SMILES for ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine is C=C(/C=C\C(=C)C(F)(F)F)N(C)CCC(C)C.CC.
What is the InChIKey of ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine?
The InChIKey is ZUIMWVSTSWYIOJ-NAFXZHHSSA-N. The full InChI is InChI=1S/C13H20F3N.C2H6/c1-10(2)8-9-17(5)12(4)7-6-11(3)13(14,15)16;1-2/h6-7,10H,3-4,8-9H2,1-2,5H3;1-2H3/b7-6-;.
What are the key properties of ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine?
ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine has a molecular weight of 277.37 g/mol, XLogP of 5.18, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine is sourced from PubChem (CID 144589102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).