About [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol
[(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol (PubChem CID 144589140) has the molecular formula C13H20FN3O2
and a molecular weight of 269.32 g/mol. Its IUPAC name is [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol |
| PubChem CID | 144589140 |
| Molecular Formula | C13H20FN3O2 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol |
| SMILES | CNc1cncc(F)c1CC[C@@H]1CN[C@H](CO)CO1 |
| InChI | InChI=1S/C13H20FN3O2/c1-15-13-6-16-5-12(14)11(13)3-2-10-4-17-9(7-18)8-19-10/h5-6,9-10,15,17-18H,2-4,7-8H2,1H3/t9-,10-/m1/s1 |
| InChIKey | XKYMAEKCLIEKQC-NXEZZACHSA-N |
| XLogP | 0.54 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol?
The IUPAC name of [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol (CID 144589140) is [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol.
What is the SMILES notation for [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol?
The canonical SMILES for [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol is CNc1cncc(F)c1CC[C@@H]1CN[C@H](CO)CO1.
What is the InChIKey of [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol?
The InChIKey is XKYMAEKCLIEKQC-NXEZZACHSA-N. The full InChI is InChI=1S/C13H20FN3O2/c1-15-13-6-16-5-12(14)11(13)3-2-10-4-17-9(7-18)8-19-10/h5-6,9-10,15,17-18H,2-4,7-8H2,1H3/t9-,10-/m1/s1.
What are the key properties of [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol?
[(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol has a molecular weight of 269.32 g/mol, XLogP of 0.54, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,6R)-6-[2-[3-fluoro-5-(methylamino)-4-pyridinyl]ethyl]morpholin-3-yl]methanol is sourced from PubChem (CID 144589140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).