About ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline
ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline (PubChem CID 144589175) has the molecular formula C14H26N2O
and a molecular weight of 238.38 g/mol. Its IUPAC name is ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline.
Molecular Properties
| Compound Name | ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline |
| PubChem CID | 144589175 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline |
| SMILES | C=C.Nc1ccccc1CC[C@@H]1CNCCO1.[H][H].[H][H] |
| InChI | InChI=1S/C12H18N2O.C2H4.2H2/c13-12-4-2-1-3-10(12)5-6-11-9-14-7-8-15-11;1-2;;/h1-4,11,14H,5-9,13H2;1-2H2;2*1H/t11-;;;/m1.../s1 |
| InChIKey | RSLSIAMEDOIGKZ-HCEFKKQBSA-N |
| XLogP | 2.48 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline?
The IUPAC name of ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline (CID 144589175) is ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline.
What is the SMILES notation for ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline?
The canonical SMILES for ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline is C=C.Nc1ccccc1CC[C@@H]1CNCCO1.[H][H].[H][H].
What is the InChIKey of ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline?
The InChIKey is RSLSIAMEDOIGKZ-HCEFKKQBSA-N. The full InChI is InChI=1S/C12H18N2O.C2H4.2H2/c13-12-4-2-1-3-10(12)5-6-11-9-14-7-8-15-11;1-2;;/h1-4,11,14H,5-9,13H2;1-2H2;2*1H/t11-;;;/m1.../s1.
What are the key properties of ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline?
ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline has a molecular weight of 238.38 g/mol, XLogP of 2.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;molecular hydrogen;2-[2-[(2R)-morpholin-2-yl]ethyl]aniline is sourced from PubChem (CID 144589175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).