C24H28N2O — CID 144589623
(2S)-6-methyl-7-[(1R)-1-(5,6,7,8-tetrahydrobenzo[f]benzimidazol-3-yl)ethyl]-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 144589623) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is (2S)-6-methyl-7-[(1R)-1-(5,6,7,8-tetrahydrobenzo[f]benzimidazol-3-yl)ethyl]-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2S)-6-methyl-7-[(1R)-1-(5,6,7,8-tetrahydrobenzo[f]benzimidazol-3-yl)ethyl]-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 144589623 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | (2S)-6-methyl-7-[(1R)-1-(5,6,7,8-tetrahydrobenzo[f]benzimidazol-3-yl)ethyl]-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | Cc1cc2c(cc1[C@@H](C)n1cnc3cc4c(cc31)CCCC4)C[C@@H](O)CC2 |
| InChI | InChI=1S/C24H28N2O/c1-15-9-19-7-8-21(27)10-20(19)11-22(15)16(2)26-14-25-23-12-17-5-3-4-6-18(17)13-24(23)26/h9,11-14,16,21,27H,3-8,10H2,1-2H3/t16-,21+/m1/s1 |
| InChIKey | IMQQTUNBMVTWDT-IERDGZPVSA-N |
| XLogP | 4.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |