C7H10Cl2N2O — CID 144589632
4,6-dichloro-5-methoxypyrimidine;ethane (PubChem CID 144589632) has the molecular formula C7H10Cl2N2O and a molecular weight of 209.08 g/mol. Its IUPAC name is 4,6-dichloro-5-methoxypyrimidine;ethane.
| Compound Name | 4,6-dichloro-5-methoxypyrimidine;ethane |
|---|---|
| PubChem CID | 144589632 |
| Molecular Formula | C7H10Cl2N2O |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 4,6-dichloro-5-methoxypyrimidine;ethane |
| SMILES | CC.COc1c(Cl)ncnc1Cl |
| InChI | InChI=1S/C5H4Cl2N2O.C2H6/c1-10-3-4(6)8-2-9-5(3)7;1-2/h2H,1H3;1-2H3 |
| InChIKey | LMMSLPICWOGIGZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |