C9H17FN2 — CID 144589819
(3aR,6aS)-3a-ethyl-6a-fluoro-1-methyl-3,4,5,6-tetrahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 144589819) has the molecular formula C9H17FN2 and a molecular weight of 172.25 g/mol. Its IUPAC name is (3aR,6aS)-3a-ethyl-6a-fluoro-1-methyl-3,4,5,6-tetrahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aR,6aS)-3a-ethyl-6a-fluoro-1-methyl-3,4,5,6-tetrahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 144589819 |
| Molecular Formula | C9H17FN2 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | (3aR,6aS)-3a-ethyl-6a-fluoro-1-methyl-3,4,5,6-tetrahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | CC[C@]12CCN(C)[C@@]1(F)CNC2 |
| InChI | InChI=1S/C9H17FN2/c1-3-8-4-5-12(2)9(8,10)7-11-6-8/h11H,3-7H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | WXIFGBNJGAJEHD-BDAKNGLRSA-N |
| XLogP | 0.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|