C15H9BrFIN2O2 — CID 14459004
3-[(4-bromo-2-fluorophenyl)methyl]-7-iodo-1H-quinazoline-2,4-dione (PubChem CID 14459004) has the molecular formula C15H9BrFIN2O2 and a molecular weight of 475.06 g/mol. Its IUPAC name is 3-[(4-bromo-2-fluorophenyl)methyl]-7-iodo-1H-quinazoline-2,4-dione.
| Compound Name | 3-[(4-bromo-2-fluorophenyl)methyl]-7-iodo-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 14459004 |
| Molecular Formula | C15H9BrFIN2O2 |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 473.89 |
| IUPAC Name | 3-[(4-bromo-2-fluorophenyl)methyl]-7-iodo-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cc(I)ccc2c(=O)n1Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C15H9BrFIN2O2/c16-9-2-1-8(12(17)5-9)7-20-14(21)11-4-3-10(18)6-13(11)19-15(20)22/h1-6H,7H2,(H,19,22) |
| InChIKey | GXPHFZFFMDRXDM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|