C27H37FN4O — CID 144590296
(2E,4Z)-N-[4-[ethyl-[(6-methyl-3-pyridinyl)methyl]amino]butan-2-yl]-5-fluoro-2-methyl-4-(4-methyl-3,4-dihydropyridin-3-yl)hepta-2,4,6-trienamide (PubChem CID 144590296) has the molecular formula C27H37FN4O and a molecular weight of 452.62 g/mol. Its IUPAC name is (2E,4Z)-N-[4-[ethyl-[(6-methyl-3-pyridinyl)methyl]amino]butan-2-yl]-5-fluoro-2-methyl-4-(4-methyl-3,4-dihydropyridin-3-yl)hepta-2,4,6-trienamide.
| Compound Name | (2E,4Z)-N-[4-[ethyl-[(6-methyl-3-pyridinyl)methyl]amino]butan-2-yl]-5-fluoro-2-methyl-4-(4-methyl-3,4-dihydropyridin-3-yl)hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 144590296 |
| Molecular Formula | C27H37FN4O |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | (2E,4Z)-N-[4-[ethyl-[(6-methyl-3-pyridinyl)methyl]amino]butan-2-yl]-5-fluoro-2-methyl-4-(4-methyl-3,4-dihydropyridin-3-yl)hepta-2,4,6-trienamide |
| SMILES | C=C/C(F)=C(\C=C(/C)C(=O)NC(C)CCN(CC)Cc1ccc(C)nc1)C1C=NC=CC1C |
| InChI | InChI=1S/C27H37FN4O/c1-7-26(28)24(25-17-29-13-11-19(25)3)15-20(4)27(33)31-22(6)12-14-32(8-2)18-23-10-9-21(5)30-16-23/h7,9-11,13,15-17,19,22,25H,1,8,12,14,18H2,2-6H3,(H,31,33)/b20-15+,26-24- |
| InChIKey | WEBOERUMHXZATB-WBIFNQKVSA-N |
| XLogP | 5.31 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|