C9H16NO3PS2 — CID 144590394
dimethyl hydrogen phosphite;4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-thiol (PubChem CID 144590394) has the molecular formula C9H16NO3PS2 and a molecular weight of 281.34 g/mol. Its IUPAC name is dimethyl hydrogen phosphite;4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-thiol.
| Compound Name | dimethyl hydrogen phosphite;4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-thiol |
|---|---|
| PubChem CID | 144590394 |
| Molecular Formula | C9H16NO3PS2 |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | dimethyl hydrogen phosphite;4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-thiol |
| SMILES | COP(O)OC.Sc1cc2c(s1)CCNC2 |
| InChI | InChI=1S/C7H9NS2.C2H7O3P/c9-7-3-5-4-8-2-1-6(5)10-7;1-4-6(3)5-2/h3,8-9H,1-2,4H2;3H,1-2H3 |
| InChIKey | ZTDYCPVTBMPVND-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|