C13H9NO7 — CID 144590845
12,13-dihydroxy-10,15-dioxa-1-azatricyclo[7.6.1.02,7]hexadeca-2,4,6,8-tetraene-11,14,16-trione (PubChem CID 144590845) has the molecular formula C13H9NO7 and a molecular weight of 291.21 g/mol. Its IUPAC name is 12,13-dihydroxy-10,15-dioxa-1-azatricyclo[7.6.1.02,7]hexadeca-2,4,6,8-tetraene-11,14,16-trione.
| Compound Name | 12,13-dihydroxy-10,15-dioxa-1-azatricyclo[7.6.1.02,7]hexadeca-2,4,6,8-tetraene-11,14,16-trione |
|---|---|
| PubChem CID | 144590845 |
| Molecular Formula | C13H9NO7 |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 12,13-dihydroxy-10,15-dioxa-1-azatricyclo[7.6.1.02,7]hexadeca-2,4,6,8-tetraene-11,14,16-trione |
| SMILES | O=C1Oc2cc3ccccc3n(c2=O)OC(=O)C(O)C1O |
| InChI | InChI=1S/C13H9NO7/c15-9-10(16)13(19)21-14-7-4-2-1-3-6(7)5-8(11(14)17)20-12(9)18/h1-5,9-10,15-16H |
| InChIKey | VEYCDBDOCFZFSJ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |