About N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide
N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide (PubChem CID 14459138) has the molecular formula C18H20N4O3S2
and a molecular weight of 404.52 g/mol. Its IUPAC name is N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide |
| PubChem CID | 14459138 |
| Molecular Formula | C18H20N4O3S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide |
| SMILES | Cc1cc(C)nc(-n2ccnc2S(=O)Cc2ccccc2NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H20N4O3S2/c1-13-10-14(2)20-17(11-13)22-9-8-19-18(22)26(23)12-15-6-4-5-7-16(15)21-27(3,24)25/h4-11,21H,12H2,1-3H3 |
| InChIKey | ZQIVRLQGHCBMTK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide?
The IUPAC name of N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide (CID 14459138) is N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide?
The canonical SMILES for N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide is Cc1cc(C)nc(-n2ccnc2S(=O)Cc2ccccc2NS(C)(=O)=O)c1.
What is the InChIKey of N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide?
The InChIKey is ZQIVRLQGHCBMTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O3S2/c1-13-10-14(2)20-17(11-13)22-9-8-19-18(22)26(23)12-15-6-4-5-7-16(15)21-27(3,24)25/h4-11,21H,12H2,1-3H3.
What are the key properties of N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide?
N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide has a molecular weight of 404.52 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[1-(4,6-dimethyl-2-pyridinyl)imidazol-2-yl]sulfinylmethyl]phenyl]methanesulfonamide is sourced from PubChem (CID 14459138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).