About 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane
3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane (PubChem CID 144591565) has the molecular formula C14H17ClF3NO
and a molecular weight of 307.74 g/mol. Its IUPAC name is 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane.
Molecular Properties
| Compound Name | 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane |
| PubChem CID | 144591565 |
| Molecular Formula | C14H17ClF3NO |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane |
| SMILES | CC.CCC1CC(c2cccc(C(F)(F)F)c2Cl)=NO1 |
| InChI | InChI=1S/C12H11ClF3NO.C2H6/c1-2-7-6-10(17-18-7)8-4-3-5-9(11(8)13)12(14,15)16;1-2/h3-5,7H,2,6H2,1H3;1-2H3 |
| InChIKey | LAHDDZULXACCQK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane?
The IUPAC name of 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane (CID 144591565) is 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane.
What is the SMILES notation for 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane?
The canonical SMILES for 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane is CC.CCC1CC(c2cccc(C(F)(F)F)c2Cl)=NO1.
What is the InChIKey of 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane?
The InChIKey is LAHDDZULXACCQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClF3NO.C2H6/c1-2-7-6-10(17-18-7)8-4-3-5-9(11(8)13)12(14,15)16;1-2/h3-5,7H,2,6H2,1H3;1-2H3.
What are the key properties of 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane?
3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane has a molecular weight of 307.74 g/mol, XLogP of 5.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-4,5-dihydro-1,2-oxazole;ethane is sourced from PubChem (CID 144591565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).