C13H7ClF5NS — CID 14459220
4-[2-chloro-4-(trifluoromethyl)phenyl]sulfanyl-2,5-difluoroaniline (PubChem CID 14459220) has the molecular formula C13H7ClF5NS and a molecular weight of 339.72 g/mol. Its IUPAC name is 4-[2-chloro-4-(trifluoromethyl)phenyl]sulfanyl-2,5-difluoroaniline.
| Compound Name | 4-[2-chloro-4-(trifluoromethyl)phenyl]sulfanyl-2,5-difluoroaniline |
|---|---|
| PubChem CID | 14459220 |
| Molecular Formula | C13H7ClF5NS |
| Molecular Weight | 339.72 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 4-[2-chloro-4-(trifluoromethyl)phenyl]sulfanyl-2,5-difluoroaniline |
| SMILES | Nc1cc(F)c(Sc2ccc(C(F)(F)F)cc2Cl)cc1F |
| InChI | InChI=1S/C13H7ClF5NS/c14-7-3-6(13(17,18)19)1-2-11(7)21-12-5-8(15)10(20)4-9(12)16/h1-5H,20H2 |
| InChIKey | IZQVIGKNHXFUQS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.72 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|