C33H37ClF3N3O4 — CID 144592862
2-methylpropyl (2S,3R)-3-[[(3S)-5-(4-chlorophenyl)-9-cyclopropyl-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamoyl]-2-(cyclopropylmethyl)-6,6,6-trifluorohexanoate (PubChem CID 144592862) has the molecular formula C33H37ClF3N3O4 and a molecular weight of 632.12 g/mol. Its IUPAC name is 2-methylpropyl (2S,3R)-3-[[(3S)-5-(4-chlorophenyl)-9-cyclopropyl-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamoyl]-2-(cyclopropylmethyl)-6,6,6-trifluorohexanoate.
| Compound Name | 2-methylpropyl (2S,3R)-3-[[(3S)-5-(4-chlorophenyl)-9-cyclopropyl-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamoyl]-2-(cyclopropylmethyl)-6,6,6-trifluorohexanoate |
|---|---|
| PubChem CID | 144592862 |
| Molecular Formula | C33H37ClF3N3O4 |
| Molecular Weight | 632.12 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | 2-methylpropyl (2S,3R)-3-[[(3S)-5-(4-chlorophenyl)-9-cyclopropyl-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]carbamoyl]-2-(cyclopropylmethyl)-6,6,6-trifluorohexanoate |
| SMILES | CC(C)COC(=O)[C@@H](CC1CC1)[C@@H](CCC(F)(F)F)C(=O)N[C@H]1N=C(c2ccc(Cl)cc2)c2cccc(C3CC3)c2NC1=O |
| InChI | InChI=1S/C33H37ClF3N3O4/c1-18(2)17-44-32(43)26(16-19-6-7-19)24(14-15-33(35,36)37)30(41)40-29-31(42)39-28-23(20-8-9-20)4-3-5-25(28)27(38-29)21-10-12-22(34)13-11-21/h3-5,10-13,18-20,24,26,29H,6-9,14-17H2,1-2H3,(H,39,42)(H,40,41)/t24-,26+,29-/m1/s1 |
| InChIKey | NEONDTDDXLPZBO-DOBADDLBSA-N |
| XLogP | 7.02 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.12 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |