About ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite
ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite (PubChem CID 144594239) has the molecular formula C17H25IO
and a molecular weight of 372.29 g/mol. Its IUPAC name is ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite.
Molecular Properties
| Compound Name | ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite |
| PubChem CID | 144594239 |
| Molecular Formula | C17H25IO |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite |
| SMILES | CC.Cc1ccc(OI)c2c1C1(CCCC1)CCC2 |
| InChI | InChI=1S/C15H19IO.C2H6/c1-11-6-7-13(17-16)12-5-4-10-15(14(11)12)8-2-3-9-15;1-2/h6-7H,2-5,8-10H2,1H3;1-2H3 |
| InChIKey | VXSGKGIHKOJGRD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite?
The IUPAC name of ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite (CID 144594239) is ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite.
What is the SMILES notation for ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite?
The canonical SMILES for ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite is CC.Cc1ccc(OI)c2c1C1(CCCC1)CCC2.
What is the InChIKey of ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite?
The InChIKey is VXSGKGIHKOJGRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19IO.C2H6/c1-11-6-7-13(17-16)12-5-4-10-15(14(11)12)8-2-3-9-15;1-2/h6-7H,2-5,8-10H2,1H3;1-2H3.
What are the key properties of ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite?
ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite has a molecular weight of 372.29 g/mol, XLogP of 5.90, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-methylspiro[7,8-dihydro-6H-naphthalene-5,1'-cyclopentane]-1-yl) hypoiodite is sourced from PubChem (CID 144594239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).