About ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide
ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide (PubChem CID 144594500) has the molecular formula C25H32N2O
and a molecular weight of 376.54 g/mol. Its IUPAC name is ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide |
| PubChem CID | 144594500 |
| Molecular Formula | C25H32N2O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide |
| SMILES | CC.Cc1cc(-c2cc3ccccc3cn2)cc(C)c1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C23H26N2O.C2H6/c1-15-10-19(20-12-17-8-6-7-9-18(17)14-24-20)11-16(2)22(15)25-21(26)13-23(3,4)5;1-2/h6-12,14H,13H2,1-5H3,(H,25,26);1-2H3 |
| InChIKey | HGCYOFNAQSTVOB-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide?
The IUPAC name of ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide (CID 144594500) is ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide.
What is the SMILES notation for ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide?
The canonical SMILES for ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide is CC.Cc1cc(-c2cc3ccccc3cn2)cc(C)c1NC(=O)CC(C)(C)C.
What is the InChIKey of ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide?
The InChIKey is HGCYOFNAQSTVOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O.C2H6/c1-15-10-19(20-12-17-8-6-7-9-18(17)14-24-20)11-16(2)22(15)25-21(26)13-23(3,4)5;1-2/h6-12,14H,13H2,1-5H3,(H,25,26);1-2H3.
What are the key properties of ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide?
ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide has a molecular weight of 376.54 g/mol, XLogP of 6.92, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(4-isoquinolin-3-yl-2,6-dimethylphenyl)-3,3-dimethylbutanamide is sourced from PubChem (CID 144594500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).