C17H25N3O3 — CID 144594517
4-[1-(3,5-dimethyl-4-nitrophenyl)piperidin-4-yl]morpholine (PubChem CID 144594517) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 4-[1-(3,5-dimethyl-4-nitrophenyl)piperidin-4-yl]morpholine.
| Compound Name | 4-[1-(3,5-dimethyl-4-nitrophenyl)piperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 144594517 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 4-[1-(3,5-dimethyl-4-nitrophenyl)piperidin-4-yl]morpholine |
| SMILES | Cc1cc(N2CCC(N3CCOCC3)CC2)cc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N3O3/c1-13-11-16(12-14(2)17(13)20(21)22)18-5-3-15(4-6-18)19-7-9-23-10-8-19/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | YEQOUAXRVZKNGO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|