C13H21NO — CID 144594985
4-[(2E)-2-ethenyl-5-methylhexa-2,4-dienyl]morpholine (PubChem CID 144594985) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-[(2E)-2-ethenyl-5-methylhexa-2,4-dienyl]morpholine.
| Compound Name | 4-[(2E)-2-ethenyl-5-methylhexa-2,4-dienyl]morpholine |
|---|---|
| PubChem CID | 144594985 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 4-[(2E)-2-ethenyl-5-methylhexa-2,4-dienyl]morpholine |
| SMILES | C=C/C(=C\C=C(C)C)CN1CCOCC1 |
| InChI | InChI=1S/C13H21NO/c1-4-13(6-5-12(2)3)11-14-7-9-15-10-8-14/h4-6H,1,7-11H2,2-3H3/b13-6+ |
| InChIKey | FUOVAFHUDMUGGL-AWNIVKPZSA-N |
| XLogP | 2.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|