About 4-aminooxepan-3-one
4-aminooxepan-3-one (PubChem CID 144595232) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 4-aminooxepan-3-one.
Molecular Properties
| Compound Name | 4-aminooxepan-3-one |
| PubChem CID | 144595232 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 4-aminooxepan-3-one |
| SMILES | NC1CCCOCC1=O |
| InChI | InChI=1S/C6H11NO2/c7-5-2-1-3-9-4-6(5)8/h5H,1-4,7H2 |
| InChIKey | KDQLXJZYTJQEDV-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-aminooxepan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminooxepan-3-one?
The IUPAC name of 4-aminooxepan-3-one (CID 144595232) is 4-aminooxepan-3-one.
What is the SMILES notation for 4-aminooxepan-3-one?
The canonical SMILES for 4-aminooxepan-3-one is NC1CCCOCC1=O.
What is the InChIKey of 4-aminooxepan-3-one?
The InChIKey is KDQLXJZYTJQEDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c7-5-2-1-3-9-4-6(5)8/h5H,1-4,7H2.
What are the key properties of 4-aminooxepan-3-one?
4-aminooxepan-3-one has a molecular weight of 129.16 g/mol, XLogP of -0.31, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminooxepan-3-one is sourced from PubChem (CID 144595232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).