C12H10F3N3O2S — CID 144595503
4-(3-sulfanylidene-1,2,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 144595503) has the molecular formula C12H10F3N3O2S and a molecular weight of 317.29 g/mol. Its IUPAC name is 4-(3-sulfanylidene-1,2,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 4-(3-sulfanylidene-1,2,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 144595503 |
| Molecular Formula | C12H10F3N3O2S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 4-(3-sulfanylidene-1,2,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | O=C(NCCC(F)(F)F)c1ccc(-c2nc(=S)[nH]o2)cc1 |
| InChI | InChI=1S/C12H10F3N3O2S/c13-12(14,15)5-6-16-9(19)7-1-3-8(4-2-7)10-17-11(21)18-20-10/h1-4H,5-6H2,(H,16,19)(H,18,21) |
| InChIKey | MLMIRDGEWXDOTF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|