C12H11F3N2O3S — CID 144595506
[(Z)-N-sulfanyl-C-[4-(3,3,3-trifluoropropylcarbamoyl)phenyl]carbonimidoyl] formate (PubChem CID 144595506) has the molecular formula C12H11F3N2O3S and a molecular weight of 320.29 g/mol. Its IUPAC name is [(Z)-N-sulfanyl-C-[4-(3,3,3-trifluoropropylcarbamoyl)phenyl]carbonimidoyl] formate.
| Compound Name | [(Z)-N-sulfanyl-C-[4-(3,3,3-trifluoropropylcarbamoyl)phenyl]carbonimidoyl] formate |
|---|---|
| PubChem CID | 144595506 |
| Molecular Formula | C12H11F3N2O3S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | [(Z)-N-sulfanyl-C-[4-(3,3,3-trifluoropropylcarbamoyl)phenyl]carbonimidoyl] formate |
| SMILES | O=CO/C(=N\S)c1ccc(C(=O)NCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3N2O3S/c13-12(14,15)5-6-16-10(19)8-1-3-9(4-2-8)11(17-21)20-7-18/h1-4,7,21H,5-6H2,(H,16,19)/b17-11- |
| InChIKey | NQTRHQAMBPNPLJ-BOPFTXTBSA-N |
| XLogP | 2.13 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|