C18H21F2N3O5S — CID 144596904
6-amino-7,9-difluoro-8-[2-(2-methoxyethoxy)ethylamino]-1-methyl-5-oxo-1,2-dihydro-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid (PubChem CID 144596904) has the molecular formula C18H21F2N3O5S and a molecular weight of 429.45 g/mol. Its IUPAC name is 6-amino-7,9-difluoro-8-[2-(2-methoxyethoxy)ethylamino]-1-methyl-5-oxo-1,2-dihydro-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid.
| Compound Name | 6-amino-7,9-difluoro-8-[2-(2-methoxyethoxy)ethylamino]-1-methyl-5-oxo-1,2-dihydro-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 144596904 |
| Molecular Formula | C18H21F2N3O5S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 6-amino-7,9-difluoro-8-[2-(2-methoxyethoxy)ethylamino]-1-methyl-5-oxo-1,2-dihydro-[1,3]thiazolo[3,2-a]quinoline-4-carboxylic acid |
| SMILES | COCCOCCNc1c(F)c(N)c2c(=O)c(C(=O)O)c3n(c2c1F)C(C)CS3 |
| InChI | InChI=1S/C18H21F2N3O5S/c1-8-7-29-17-10(18(25)26)16(24)9-13(21)11(19)14(12(20)15(9)23(8)17)22-3-4-28-6-5-27-2/h8,22H,3-7,21H2,1-2H3,(H,25,26) |
| InChIKey | PZEMGFRRGAOLDY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|