C25H23O3P — CID 144597456
(2-diphenylphosphanylcarbonyl-3,5-dimethylphenyl)methyl prop-2-enoate (PubChem CID 144597456) has the molecular formula C25H23O3P and a molecular weight of 402.43 g/mol. Its IUPAC name is (2-diphenylphosphanylcarbonyl-3,5-dimethylphenyl)methyl prop-2-enoate.
| Compound Name | (2-diphenylphosphanylcarbonyl-3,5-dimethylphenyl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 144597456 |
| Molecular Formula | C25H23O3P |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (2-diphenylphosphanylcarbonyl-3,5-dimethylphenyl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cc(C)cc(C)c1C(=O)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23O3P/c1-4-23(26)28-17-20-16-18(2)15-19(3)24(20)25(27)29(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h4-16H,1,17H2,2-3H3 |
| InChIKey | QYAVDKVSRBZEPD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|