About ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol
ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol (PubChem CID 144598110) has the molecular formula C10H15F3O
and a molecular weight of 208.22 g/mol. Its IUPAC name is ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol |
| PubChem CID | 144598110 |
| Molecular Formula | C10H15F3O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol |
| SMILES | CC.CC1=CC(C(F)(F)F)=C(O)CC1 |
| InChI | InChI=1S/C8H9F3O.C2H6/c1-5-2-3-7(12)6(4-5)8(9,10)11;1-2/h4,12H,2-3H2,1H3;1-2H3 |
| InChIKey | BSHSZEJCRMYUOZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol?
The IUPAC name of ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol (CID 144598110) is ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol.
What is the SMILES notation for ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol?
The canonical SMILES for ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol is CC.CC1=CC(C(F)(F)F)=C(O)CC1.
What is the InChIKey of ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol?
The InChIKey is BSHSZEJCRMYUOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3O.C2H6/c1-5-2-3-7(12)6(4-5)8(9,10)11;1-2/h4,12H,2-3H2,1H3;1-2H3.
What are the key properties of ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol?
ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol has a molecular weight of 208.22 g/mol, XLogP of 4.13, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-2-(trifluoromethyl)cyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 144598110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).