C24H31NO4SSi — CID 14459973
5-[[4-[1-[tert-butyl(dimethyl)silyl]oxy-2-phenoxyethyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 14459973) has the molecular formula C24H31NO4SSi and a molecular weight of 457.67 g/mol. Its IUPAC name is 5-[[4-[1-[tert-butyl(dimethyl)silyl]oxy-2-phenoxyethyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[1-[tert-butyl(dimethyl)silyl]oxy-2-phenoxyethyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 14459973 |
| Molecular Formula | C24H31NO4SSi |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 5-[[4-[1-[tert-butyl(dimethyl)silyl]oxy-2-phenoxyethyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC(COc1ccccc1)c1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C24H31NO4SSi/c1-24(2,3)31(4,5)29-20(16-28-19-9-7-6-8-10-19)18-13-11-17(12-14-18)15-21-22(26)25-23(27)30-21/h6-14,20-21H,15-16H2,1-5H3,(H,25,26,27) |
| InChIKey | ZWMMQHVWWZEWID-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|