C21H14N2O2S — CID 14459979
15-oxo-N-phenyl-8-thia-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16)-hexaene-14-carboxamide (PubChem CID 14459979) has the molecular formula C21H14N2O2S and a molecular weight of 358.42 g/mol. Its IUPAC name is 15-oxo-N-phenyl-8-thia-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16)-hexaene-14-carboxamide.
| Compound Name | 15-oxo-N-phenyl-8-thia-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16)-hexaene-14-carboxamide |
|---|---|
| PubChem CID | 14459979 |
| Molecular Formula | C21H14N2O2S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 15-oxo-N-phenyl-8-thia-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16)-hexaene-14-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1C(=O)N2c3ccccc3Sc3cccc1c32 |
| InChI | InChI=1S/C21H14N2O2S/c24-20(22-13-7-2-1-3-8-13)18-14-9-6-12-17-19(14)23(21(18)25)15-10-4-5-11-16(15)26-17/h1-12,18H,(H,22,24) |
| InChIKey | OPNFZNUANLMKDV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|