About (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane
(Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane (PubChem CID 144599794) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane.
Molecular Properties
| Compound Name | (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane |
| PubChem CID | 144599794 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane |
| SMILES | C/C=N\N1CCC(C)=CC1C.CC |
| InChI | InChI=1S/C9H16N2.C2H6/c1-4-10-11-6-5-8(2)7-9(11)3;1-2/h4,7,9H,5-6H2,1-3H3;1-2H3/b10-4-; |
| InChIKey | MQPBUKQCZRICTI-MDZFRNKHSA-N |
| XLogP | 3.06 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane?
The IUPAC name of (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane (CID 144599794) is (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane.
What is the SMILES notation for (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane?
The canonical SMILES for (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane is C/C=N\N1CCC(C)=CC1C.CC.
What is the InChIKey of (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane?
The InChIKey is MQPBUKQCZRICTI-MDZFRNKHSA-N. The full InChI is InChI=1S/C9H16N2.C2H6/c1-4-10-11-6-5-8(2)7-9(11)3;1-2/h4,7,9H,5-6H2,1-3H3;1-2H3/b10-4-;.
What are the key properties of (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane?
(Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane has a molecular weight of 182.31 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(4,6-dimethyl-3,6-dihydro-2H-pyridin-1-yl)ethanimine;ethane is sourced from PubChem (CID 144599794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).