C27H33N7O — CID 144599810
4-(5-cyclopropyl-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-N-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyethyl]pyridin-2-amine (PubChem CID 144599810) has the molecular formula C27H33N7O and a molecular weight of 471.61 g/mol. Its IUPAC name is 4-(5-cyclopropyl-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-N-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyethyl]pyridin-2-amine.
| Compound Name | 4-(5-cyclopropyl-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-N-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 144599810 |
| Molecular Formula | C27H33N7O |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 4-(5-cyclopropyl-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-N-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyethyl]pyridin-2-amine |
| SMILES | C/C=C\C(=C/C)OCCNc1cc(-c2nc(N3CCNCC3)c3c(C4CC4)cncc3n2)ccn1 |
| InChI | InChI=1S/C27H33N7O/c1-3-5-21(4-2)35-15-12-31-24-16-20(8-9-30-24)26-32-23-18-29-17-22(19-6-7-19)25(23)27(33-26)34-13-10-28-11-14-34/h3-5,8-9,16-19,28H,6-7,10-15H2,1-2H3,(H,30,31)/b5-3-,21-4+ |
| InChIKey | HYCNHDOEPIXWRS-RBNYAZLMSA-N |
| XLogP | 4.28 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|