About (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole
(4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole (PubChem CID 144599887) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole.
Molecular Properties
| Compound Name | (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole |
| PubChem CID | 144599887 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole |
| SMILES | C=C/C=c1/c(C(C)C)nsc1=C |
| InChI | InChI=1S/C10H13NS/c1-5-6-9-8(4)12-11-10(9)7(2)3/h5-7H,1,4H2,2-3H3/b9-6+ |
| InChIKey | PAPCGGPGDXUEDY-RMKNXTFCSA-N |
| XLogP | 1.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole?
The IUPAC name of (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole (CID 144599887) is (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole.
What is the SMILES notation for (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole?
The canonical SMILES for (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole is C=C/C=c1/c(C(C)C)nsc1=C.
What is the InChIKey of (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole?
The InChIKey is PAPCGGPGDXUEDY-RMKNXTFCSA-N. The full InChI is InChI=1S/C10H13NS/c1-5-6-9-8(4)12-11-10(9)7(2)3/h5-7H,1,4H2,2-3H3/b9-6+.
What are the key properties of (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole?
(4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole has a molecular weight of 179.29 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-5-methylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole is sourced from PubChem (CID 144599887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).