C22H14F2N2O2 — CID 14459993
N-(2,4-difluorophenyl)-15-oxo-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12-hexaene-14-carboxamide (PubChem CID 14459993) has the molecular formula C22H14F2N2O2 and a molecular weight of 376.36 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-15-oxo-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12-hexaene-14-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-15-oxo-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12-hexaene-14-carboxamide |
|---|---|
| PubChem CID | 14459993 |
| Molecular Formula | C22H14F2N2O2 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-15-oxo-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12-hexaene-14-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C1C(=O)N2c3ccccc3Cc3cccc1c32 |
| InChI | InChI=1S/C22H14F2N2O2/c23-14-8-9-17(16(24)11-14)25-21(27)19-15-6-3-5-13-10-12-4-1-2-7-18(12)26(20(13)15)22(19)28/h1-9,11,19H,10H2,(H,25,27) |
| InChIKey | GJLDPGXQDWKZDK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|