About ethane;3-methoxy-N,N-dimethylbutan-1-amine
ethane;3-methoxy-N,N-dimethylbutan-1-amine (PubChem CID 144600046) has the molecular formula C9H23NO
and a molecular weight of 161.29 g/mol. Its IUPAC name is ethane;3-methoxy-N,N-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | ethane;3-methoxy-N,N-dimethylbutan-1-amine |
| PubChem CID | 144600046 |
| Molecular Formula | C9H23NO |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.18 |
| IUPAC Name | ethane;3-methoxy-N,N-dimethylbutan-1-amine |
| SMILES | CC.COC(C)CCN(C)C |
| InChI | InChI=1S/C7H17NO.C2H6/c1-7(9-4)5-6-8(2)3;1-2/h7H,5-6H2,1-4H3;1-2H3 |
| InChIKey | QWAFHMAHDFFOBH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-methoxy-N,N-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methoxy-N,N-dimethylbutan-1-amine?
The IUPAC name of ethane;3-methoxy-N,N-dimethylbutan-1-amine (CID 144600046) is ethane;3-methoxy-N,N-dimethylbutan-1-amine.
What is the SMILES notation for ethane;3-methoxy-N,N-dimethylbutan-1-amine?
The canonical SMILES for ethane;3-methoxy-N,N-dimethylbutan-1-amine is CC.COC(C)CCN(C)C.
What is the InChIKey of ethane;3-methoxy-N,N-dimethylbutan-1-amine?
The InChIKey is QWAFHMAHDFFOBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO.C2H6/c1-7(9-4)5-6-8(2)3;1-2/h7H,5-6H2,1-4H3;1-2H3.
What are the key properties of ethane;3-methoxy-N,N-dimethylbutan-1-amine?
ethane;3-methoxy-N,N-dimethylbutan-1-amine has a molecular weight of 161.29 g/mol, XLogP of 2.00, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methoxy-N,N-dimethylbutan-1-amine is sourced from PubChem (CID 144600046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).