C23H17ClN2O2 — CID 14460009
N-(4-chlorophenyl)-16-oxo-1-azatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13-hexaene-15-carboxamide (PubChem CID 14460009) has the molecular formula C23H17ClN2O2 and a molecular weight of 388.85 g/mol. Its IUPAC name is N-(4-chlorophenyl)-16-oxo-1-azatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13-hexaene-15-carboxamide.
| Compound Name | N-(4-chlorophenyl)-16-oxo-1-azatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 14460009 |
| Molecular Formula | C23H17ClN2O2 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-(4-chlorophenyl)-16-oxo-1-azatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13-hexaene-15-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C1C(=O)N2c3ccccc3CCc3cccc1c32 |
| InChI | InChI=1S/C23H17ClN2O2/c24-16-10-12-17(13-11-16)25-22(27)20-18-6-3-5-15-9-8-14-4-1-2-7-19(14)26(21(15)18)23(20)28/h1-7,10-13,20H,8-9H2,(H,25,27) |
| InChIKey | SBKJAILDPYLYML-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|