C22H13F3N2O2 — CID 14460022
N-(2,5-difluorophenyl)-5-fluoro-15-oxo-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12-hexaene-14-carboxamide (PubChem CID 14460022) has the molecular formula C22H13F3N2O2 and a molecular weight of 394.35 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-5-fluoro-15-oxo-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12-hexaene-14-carboxamide.
| Compound Name | N-(2,5-difluorophenyl)-5-fluoro-15-oxo-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12-hexaene-14-carboxamide |
|---|---|
| PubChem CID | 14460022 |
| Molecular Formula | C22H13F3N2O2 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-(2,5-difluorophenyl)-5-fluoro-15-oxo-1-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12-hexaene-14-carboxamide |
| SMILES | O=C(Nc1cc(F)ccc1F)C1C(=O)N2c3ccc(F)cc3Cc3cccc1c32 |
| InChI | InChI=1S/C22H13F3N2O2/c23-13-5-7-18-12(9-13)8-11-2-1-3-15-19(22(29)27(18)20(11)15)21(28)26-17-10-14(24)4-6-16(17)25/h1-7,9-10,19H,8H2,(H,26,28) |
| InChIKey | UYDYGHBMEHKGCU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|