About butane;3,4-dimethylidenepyrrolidine
butane;3,4-dimethylidenepyrrolidine (PubChem CID 144600231) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is butane;3,4-dimethylidenepyrrolidine.
Molecular Properties
| Compound Name | butane;3,4-dimethylidenepyrrolidine |
| PubChem CID | 144600231 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | butane;3,4-dimethylidenepyrrolidine |
| SMILES | C=C1CNCC1=C.CCCC |
| InChI | InChI=1S/C6H9N.C4H10/c1-5-3-7-4-6(5)2;1-3-4-2/h7H,1-4H2;3-4H2,1-2H3 |
| InChIKey | PHYGZGVKPDGKRP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;3,4-dimethylidenepyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;3,4-dimethylidenepyrrolidine?
The IUPAC name of butane;3,4-dimethylidenepyrrolidine (CID 144600231) is butane;3,4-dimethylidenepyrrolidine.
What is the SMILES notation for butane;3,4-dimethylidenepyrrolidine?
The canonical SMILES for butane;3,4-dimethylidenepyrrolidine is C=C1CNCC1=C.CCCC.
What is the InChIKey of butane;3,4-dimethylidenepyrrolidine?
The InChIKey is PHYGZGVKPDGKRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N.C4H10/c1-5-3-7-4-6(5)2;1-3-4-2/h7H,1-4H2;3-4H2,1-2H3.
What are the key properties of butane;3,4-dimethylidenepyrrolidine?
butane;3,4-dimethylidenepyrrolidine has a molecular weight of 153.27 g/mol, XLogP of 2.51, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;3,4-dimethylidenepyrrolidine is sourced from PubChem (CID 144600231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).